C12H14N6O3 — CID 135721024
N-[3-(dimethylcarbamoyl)-2-hydroxy-5-methylphenyl]-2H-tetrazole-5-carboxamide (PubChem CID 135721024) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-[3-(dimethylcarbamoyl)-2-hydroxy-5-methylphenyl]-2H-tetrazole-5-carboxamide.
| Compound Name | N-[3-(dimethylcarbamoyl)-2-hydroxy-5-methylphenyl]-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 135721024 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-[3-(dimethylcarbamoyl)-2-hydroxy-5-methylphenyl]-2H-tetrazole-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2nn[nH]n2)c(O)c(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C12H14N6O3/c1-6-4-7(12(21)18(2)3)9(19)8(5-6)13-11(20)10-14-16-17-15-10/h4-5,19H,1-3H3,(H,13,20)(H,14,15,16,17) |
| InChIKey | GBVDRUVQAMNNQI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|