About 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide
2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide (PubChem CID 135703080) has the molecular formula C10H9N9O2
and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide |
| PubChem CID | 135703080 |
| Molecular Formula | C10H9N9O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2nn[nH]n2)c(O)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C10H9N9O2/c1-4-2-5(8-12-16-17-13-8)7(20)6(3-4)9(21)11-10-14-18-19-15-10/h2-3,20H,1H3,(H,12,13,16,17)(H2,11,14,15,18,19,21) |
| InChIKey | FTMQNPNLHCQJLH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 158.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide?
The IUPAC name of 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide (CID 135703080) is 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide.
What is the SMILES notation for 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide?
The canonical SMILES for 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide is Cc1cc(C(=O)Nc2nn[nH]n2)c(O)c(-c2nn[nH]n2)c1.
What is the InChIKey of 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide?
The InChIKey is FTMQNPNLHCQJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N9O2/c1-4-2-5(8-12-16-17-13-8)7(20)6(3-4)9(21)11-10-14-18-19-15-10/h2-3,20H,1H3,(H,12,13,16,17)(H2,11,14,15,18,19,21).
What are the key properties of 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide?
2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide has a molecular weight of 287.24 g/mol, XLogP of -0.35, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-methyl-N,3-bis(2H-tetrazol-5-yl)benzamide is sourced from PubChem (CID 135703080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).