C20H30N5O2S+ — CID 135722946
diethyl-[2-[2-hydroxy-3-[[(2S)-oxolan-2-yl]methylcarbamothioyldiazenyl]indol-1-yl]ethyl]azanium (PubChem CID 135722946) has the molecular formula C20H30N5O2S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is diethyl-[2-[2-hydroxy-3-[[(2S)-oxolan-2-yl]methylcarbamothioyldiazenyl]indol-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[2-hydroxy-3-[[(2S)-oxolan-2-yl]methylcarbamothioyldiazenyl]indol-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 135722946 |
| Molecular Formula | C20H30N5O2S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | diethyl-[2-[2-hydroxy-3-[[(2S)-oxolan-2-yl]methylcarbamothioyldiazenyl]indol-1-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCn1c(O)c(/N=N/C(=S)NC[C@@H]2CCCO2)c2ccccc21 |
| InChI | InChI=1S/C20H29N5O2S/c1-3-24(4-2)11-12-25-17-10-6-5-9-16(17)18(19(25)26)22-23-20(28)21-14-15-8-7-13-27-15/h5-6,9-10,15,26H,3-4,7-8,11-14H2,1-2H3,(H,21,28)/p+1/b23-22+/t15-/m0/s1 |
| InChIKey | FIWLURZITLXNOI-RTDLDRDPSA-O |
| XLogP | 2.41 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|