C21H15N3O4S — CID 135723695
2-benzyl-1,3-dihydroxy-N-(thiophene-2-carbonylimino)isoindole-5-carboxamide (PubChem CID 135723695) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-benzyl-1,3-dihydroxy-N-(thiophene-2-carbonylimino)isoindole-5-carboxamide.
| Compound Name | 2-benzyl-1,3-dihydroxy-N-(thiophene-2-carbonylimino)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 135723695 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-benzyl-1,3-dihydroxy-N-(thiophene-2-carbonylimino)isoindole-5-carboxamide |
| SMILES | O=C(/N=N/C(=O)c1cccs1)c1ccc2c(O)n(Cc3ccccc3)c(O)c2c1 |
| InChI | InChI=1S/C21H15N3O4S/c25-18(22-23-19(26)17-7-4-10-29-17)14-8-9-15-16(11-14)21(28)24(20(15)27)12-13-5-2-1-3-6-13/h1-11,27-28H,12H2/b23-22+ |
| InChIKey | LAUZPDSIWXZCBF-GHVJWSGMSA-N |
| XLogP | 4.60 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|