C19H14ClN3O4 — CID 135574222
N-(2-chlorobenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 135574222) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is N-(2-chlorobenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-(2-chlorobenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 135574222 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-(2-chlorobenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccccc3Cl)cc2c1O |
| InChI | InChI=1S/C19H14ClN3O4/c1-2-9-23-18(26)12-8-7-11(10-14(12)19(23)27)16(24)21-22-17(25)13-5-3-4-6-15(13)20/h2-8,10,26-27H,1,9H2/b22-21+ |
| InChIKey | MFZXOJOXALXQNY-QURGRASLSA-N |
| XLogP | 4.32 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|