C18H15N3O5 — CID 135795955
1,3-dihydroxy-N-(2-methylfuran-3-carbonyl)imino-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 135795955) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is 1,3-dihydroxy-N-(2-methylfuran-3-carbonyl)imino-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | 1,3-dihydroxy-N-(2-methylfuran-3-carbonyl)imino-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 135795955 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1,3-dihydroxy-N-(2-methylfuran-3-carbonyl)imino-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccoc3C)cc2c1O |
| InChI | InChI=1S/C18H15N3O5/c1-3-7-21-17(24)13-5-4-11(9-14(13)18(21)25)15(22)19-20-16(23)12-6-8-26-10(12)2/h3-6,8-9,24-25H,1,7H2,2H3/b20-19+ |
| InChIKey | KNZPTOHMSRTMFU-FMQUCBEESA-N |
| XLogP | 3.57 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|