C19H15ClN4O3S — CID 135840332
N-[(4-chlorophenyl)carbamothioylimino]-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 135840332) has the molecular formula C19H15ClN4O3S and a molecular weight of 414.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)carbamothioylimino]-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)carbamothioylimino]-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 135840332 |
| Molecular Formula | C19H15ClN4O3S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[(4-chlorophenyl)carbamothioylimino]-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCn1c(O)c2ccc(C(=O)/N=N/C(=S)Nc3ccc(Cl)cc3)cc2c1O |
| InChI | InChI=1S/C19H15ClN4O3S/c1-2-9-24-17(26)14-8-3-11(10-15(14)18(24)27)16(25)22-23-19(28)21-13-6-4-12(20)5-7-13/h2-8,10,26-27H,1,9H2,(H,21,28)/b23-22+ |
| InChIKey | VLZHGZPNSAHJAY-GHVJWSGMSA-N |
| XLogP | 4.88 |
| TPSA | 99.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|