C21H19N3O4 — CID 135840326
N-(2,4-dimethylbenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 135840326) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(2,4-dimethylbenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-(2,4-dimethylbenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 135840326 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(2,4-dimethylbenzoyl)imino-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccc(C)cc3C)cc2c1O |
| InChI | InChI=1S/C21H19N3O4/c1-4-9-24-20(27)16-8-6-14(11-17(16)21(24)28)18(25)22-23-19(26)15-7-5-12(2)10-13(15)3/h4-8,10-11,27-28H,1,9H2,2-3H3/b23-22+ |
| InChIKey | MDRRYTZUAISJEN-GHVJWSGMSA-N |
| XLogP | 4.29 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|