C20H15N3O6 — CID 135625194
N-(1,3-benzodioxole-5-carbonylimino)-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 135625194) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-(1,3-benzodioxole-5-carbonylimino)-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-(1,3-benzodioxole-5-carbonylimino)-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 135625194 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-(1,3-benzodioxole-5-carbonylimino)-1,3-dihydroxy-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccc4c(c3)OCO4)cc2c1O |
| InChI | InChI=1S/C20H15N3O6/c1-2-7-23-19(26)13-5-3-11(8-14(13)20(23)27)17(24)21-22-18(25)12-4-6-15-16(9-12)29-10-28-15/h2-6,8-9,26-27H,1,7,10H2/b22-21+ |
| InChIKey | FBAXMWLBMRLUAH-QURGRASLSA-N |
| XLogP | 3.40 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|