C17H13ClN4O6 — CID 135731111
N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 135731111) has the molecular formula C17H13ClN4O6 and a molecular weight of 404.77 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 135731111 |
| Molecular Formula | C17H13ClN4O6 |
| Molecular Weight | 404.77 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccccc21)N/N=C/c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H13ClN4O6/c18-11-5-10(17(25)13(6-11)22(26)27)7-19-20-15(23)8-21-12-3-1-2-4-14(12)28-9-16(21)24/h1-7,25H,8-9H2,(H,20,23)/b19-7+ |
| InChIKey | UPDYGJKPVFULSN-FBCYGCLPSA-N |
| XLogP | 1.83 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|