C10H10N4O2 — CID 135731679
4-(2-methyl-2,3-dihydro-1-benzofuran-7-yl)-1H-tetrazol-5-one (PubChem CID 135731679) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-(2-methyl-2,3-dihydro-1-benzofuran-7-yl)-1H-tetrazol-5-one.
| Compound Name | 4-(2-methyl-2,3-dihydro-1-benzofuran-7-yl)-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 135731679 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-(2-methyl-2,3-dihydro-1-benzofuran-7-yl)-1H-tetrazol-5-one |
| SMILES | CC1Cc2cccc(-n3nn[nH]c3=O)c2O1 |
| InChI | InChI=1S/C10H10N4O2/c1-6-5-7-3-2-4-8(9(7)16-6)14-10(15)11-12-13-14/h2-4,6H,5H2,1H3,(H,11,13,15) |
| InChIKey | GLCMOXINIRLZFH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |