C21H25N4+ — CID 135733528
N-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine (PubChem CID 135733528) has the molecular formula C21H25N4+ and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine.
| Compound Name | N-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine |
|---|---|
| PubChem CID | 135733528 |
| Molecular Formula | C21H25N4+ |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine |
| SMILES | CCn1c2ccccc2c2cc(/C=N/NC3=[NH+]CCCCC3)ccc21 |
| InChI | InChI=1S/C21H24N4/c1-2-25-19-9-6-5-8-17(19)18-14-16(11-12-20(18)25)15-23-24-21-10-4-3-7-13-22-21/h5-6,8-9,11-12,14-15H,2-4,7,10,13H2,1H3,(H,22,24)/p+1/b23-15+ |
| InChIKey | MEEZXZYIUFRUAA-HZHRSRAPSA-O |
| XLogP | 2.79 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|