C16H23N5O6 — CID 135733648
N-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-6-oxo-1H-pyrimidin-2-yl]imidazole-1-carboxamide (PubChem CID 135733648) has the molecular formula C16H23N5O6 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-6-oxo-1H-pyrimidin-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-6-oxo-1H-pyrimidin-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 135733648 |
| Molecular Formula | C16H23N5O6 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-6-oxo-1H-pyrimidin-2-yl]imidazole-1-carboxamide |
| SMILES | COCCOCCOCCOCc1cc(=O)[nH]c(NC(=O)n2ccnc2)n1 |
| InChI | InChI=1S/C16H23N5O6/c1-24-4-5-25-6-7-26-8-9-27-11-13-10-14(22)19-15(18-13)20-16(23)21-3-2-17-12-21/h2-3,10,12H,4-9,11H2,1H3,(H2,18,19,20,22,23) |
| InChIKey | JHBHDBPIPKSAED-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|