C19H19FN2O4S — CID 135735940
N-[(2,3-dimethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135735940) has the molecular formula C19H19FN2O4S and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135735940 |
| Molecular Formula | C19H19FN2O4S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | COc1cccc(C/N=C2\NS(=O)(=O)C(c3ccc(F)cc3)=C2C)c1OC |
| InChI | InChI=1S/C19H19FN2O4S/c1-12-18(13-7-9-15(20)10-8-13)27(23,24)22-19(12)21-11-14-5-4-6-16(25-2)17(14)26-3/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | NWIGYWWSDDAIDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|