C23H18N4O — CID 135736219
N-(4-methoxyphenyl)-7-phenyl-6H-imidazo[4,5-f]quinolin-9-amine (PubChem CID 135736219) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-7-phenyl-6H-imidazo[4,5-f]quinolin-9-amine.
| Compound Name | N-(4-methoxyphenyl)-7-phenyl-6H-imidazo[4,5-f]quinolin-9-amine |
|---|---|
| PubChem CID | 135736219 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(4-methoxyphenyl)-7-phenyl-6H-imidazo[4,5-f]quinolin-9-amine |
| SMILES | COc1ccc(Nc2cc(-c3ccccc3)[nH]c3ccc4ncnc4c23)cc1 |
| InChI | InChI=1S/C23H18N4O/c1-28-17-9-7-16(8-10-17)26-21-13-20(15-5-3-2-4-6-15)27-18-11-12-19-23(22(18)21)25-14-24-19/h2-14,26-27H,1H3 |
| InChIKey | WKYAMNYJJMXCKZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |