C21H23ClN4O — CID 135818950
N-(4-butoxyphenyl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine;hydrochloride (PubChem CID 135818950) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine;hydrochloride.
| Compound Name | N-(4-butoxyphenyl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine;hydrochloride |
|---|---|
| PubChem CID | 135818950 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(4-butoxyphenyl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine;hydrochloride |
| SMILES | CCCCOc1ccc(Nc2cc(C)[nH]c3ccc4ncnc4c23)cc1.Cl |
| InChI | InChI=1S/C21H22N4O.ClH/c1-3-4-11-26-16-7-5-15(6-8-16)25-19-12-14(2)24-17-9-10-18-21(20(17)19)23-13-22-18;/h5-10,12-13,24-25H,3-4,11H2,1-2H3;1H |
| InChIKey | VLDFUSWASGPZFB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|