About N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride
N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride (PubChem CID 67765153) has the molecular formula C21H23ClN4O
and a molecular weight of 382.90 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride |
| PubChem CID | 67765153 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride |
| SMILES | CCCCOc1ccc(Nc2cc(C)nc3ccc4cn[nH]c4c23)cc1.Cl |
| InChI | InChI=1S/C21H22N4O.ClH/c1-3-4-11-26-17-8-6-16(7-9-17)24-19-12-14(2)23-18-10-5-15-13-22-25-21(15)20(18)19;/h5-10,12-13H,3-4,11H2,1-2H3,(H,22,25)(H,23,24);1H |
| InChIKey | XIXSQZGOTDMFAV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride?
The IUPAC name of N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride (CID 67765153) is N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride.
What is the SMILES notation for N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride?
The canonical SMILES for N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride is CCCCOc1ccc(Nc2cc(C)nc3ccc4cn[nH]c4c23)cc1.Cl.
What is the InChIKey of N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride?
The InChIKey is XIXSQZGOTDMFAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O.ClH/c1-3-4-11-26-17-8-6-16(7-9-17)24-19-12-14(2)23-18-10-5-15-13-22-25-21(15)20(18)19;/h5-10,12-13H,3-4,11H2,1-2H3,(H,22,25)(H,23,24);1H.
What are the key properties of N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride?
N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride has a molecular weight of 382.90 g/mol, XLogP of 5.76, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butoxyphenyl)-7-methyl-1H-pyrazolo[5,4-f]quinolin-9-amine;hydrochloride is sourced from PubChem (CID 67765153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).