C21H12N3O12-3 — CID 135741227
2,4,6-tris(2,5-dioxopyrrolidin-1-yl)benzene-1,3,5-tricarboxylate (PubChem CID 135741227) has the molecular formula C21H12N3O12-3 and a molecular weight of 498.34 g/mol. Its IUPAC name is 2,4,6-tris(2,5-dioxopyrrolidin-1-yl)benzene-1,3,5-tricarboxylate.
| Compound Name | 2,4,6-tris(2,5-dioxopyrrolidin-1-yl)benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 135741227 |
| Molecular Formula | C21H12N3O12-3 |
| Molecular Weight | 498.34 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 2,4,6-tris(2,5-dioxopyrrolidin-1-yl)benzene-1,3,5-tricarboxylate |
| SMILES | O=C([O-])c1c(N2C(=O)CCC2=O)c(C(=O)[O-])c(N2C(=O)CCC2=O)c(C(=O)[O-])c1N1C(=O)CCC1=O |
| InChI | InChI=1S/C21H15N3O12/c25-7-1-2-8(26)22(7)16-13(19(31)32)17(23-9(27)3-4-10(23)28)15(21(35)36)18(14(16)20(33)34)24-11(29)5-6-12(24)30/h1-6H2,(H,31,32)(H,33,34)(H,35,36)/p-3 |
| InChIKey | VQRVZZSUIAFDCB-UHFFFAOYSA-K |
| XLogP | -4.26 |
| TPSA | 232.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.34 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|