C8H6BBrLiNO11 — CID 174924188
lithium;1-bromopyrrolidine-2,5-dione;dioxalooxyborinate (PubChem CID 174924188) has the molecular formula C8H6BBrLiNO11 and a molecular weight of 389.79 g/mol. Its IUPAC name is lithium;1-bromopyrrolidine-2,5-dione;dioxalooxyborinate.
| Compound Name | lithium;1-bromopyrrolidine-2,5-dione;dioxalooxyborinate |
|---|---|
| PubChem CID | 174924188 |
| Molecular Formula | C8H6BBrLiNO11 |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | lithium;1-bromopyrrolidine-2,5-dione;dioxalooxyborinate |
| SMILES | O=C(O)C(=O)OB([O-])OC(=O)C(=O)O.O=C1CCC(=O)N1Br.[Li+] |
| InChI | InChI=1S/C4H2BO9.C4H4BrNO2.Li/c6-1(7)3(10)13-5(12)14-4(11)2(8)9;5-6-3(7)1-2-4(6)8;/h(H,6,7)(H,8,9);1-2H2;/q-1;;+1 |
| InChIKey | NVCYLRNOHOSODZ-UHFFFAOYSA-N |
| XLogP | -5.96 |
| TPSA | 187.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|