C8H11BrClN3O4 — CID 158728774
1-aminopyrrolidine-2,5-dione;1-bromopyrrolidine-2,5-dione;hydrochloride (PubChem CID 158728774) has the molecular formula C8H11BrClN3O4 and a molecular weight of 328.55 g/mol. Its IUPAC name is 1-aminopyrrolidine-2,5-dione;1-bromopyrrolidine-2,5-dione;hydrochloride.
| Compound Name | 1-aminopyrrolidine-2,5-dione;1-bromopyrrolidine-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 158728774 |
| Molecular Formula | C8H11BrClN3O4 |
| Molecular Weight | 328.55 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 1-aminopyrrolidine-2,5-dione;1-bromopyrrolidine-2,5-dione;hydrochloride |
| SMILES | Cl.NN1C(=O)CCC1=O.O=C1CCC(=O)N1Br |
| InChI | InChI=1S/C4H4BrNO2.C4H6N2O2.ClH/c2*5-6-3(7)1-2-4(6)8;/h1-2H2;1-2,5H2;1H |
| InChIKey | QFLNNZUQDXXVRD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.55 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|