C4H6BrNO2Sn — CID 174907562
1-bromopyrrolidine-2,5-dione;λ2-stannane (PubChem CID 174907562) has the molecular formula C4H6BrNO2Sn and a molecular weight of 298.71 g/mol. Its IUPAC name is 1-bromopyrrolidine-2,5-dione;λ2-stannane.
| Compound Name | 1-bromopyrrolidine-2,5-dione;λ2-stannane |
|---|---|
| PubChem CID | 174907562 |
| Molecular Formula | C4H6BrNO2Sn |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.86 |
| IUPAC Name | 1-bromopyrrolidine-2,5-dione;λ2-stannane |
| SMILES | O=C1CCC(=O)N1Br.[SnH2] |
| InChI | InChI=1S/C4H4BrNO2.Sn.2H/c5-6-3(7)1-2-4(6)8;;;/h1-2H2;;; |
| InChIKey | IPRQDIJEPVGVTQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|