C4H5BrINO2 — CID 172714463
1-bromopyrrolidine-2,5-dione;hydroiodide (PubChem CID 172714463) has the molecular formula C4H5BrINO2 and a molecular weight of 305.90 g/mol. Its IUPAC name is 1-bromopyrrolidine-2,5-dione;hydroiodide.
| Compound Name | 1-bromopyrrolidine-2,5-dione;hydroiodide |
|---|---|
| PubChem CID | 172714463 |
| Molecular Formula | C4H5BrINO2 |
| Molecular Weight | 305.90 g/mol |
| Exact Mass | 304.85 |
| IUPAC Name | 1-bromopyrrolidine-2,5-dione;hydroiodide |
| SMILES | I.O=C1CCC(=O)N1Br |
| InChI | InChI=1S/C4H4BrNO2.HI/c5-6-3(7)1-2-4(6)8;/h1-2H2;1H |
| InChIKey | FRGDPOGNLRSXJD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.90 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|