C17H16FN3O2S — CID 135743749
N-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135743749) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135743749 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COc1ccc(/N=C2/NNC(c3ccc(F)cc3)=CS2)cc1OC |
| InChI | InChI=1S/C17H16FN3O2S/c1-22-15-8-7-13(9-16(15)23-2)19-17-21-20-14(10-24-17)11-3-5-12(18)6-4-11/h3-10,20H,1-2H3,(H,19,21) |
| InChIKey | GWNNKZSNCRRCGN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|