C12H15N3O3S — CID 142831926
4-(3,4-dimethoxyphenyl)-N'-hydroxy-2,3-dihydro-1,3-thiazole-2-carboximidamide (PubChem CID 142831926) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N'-hydroxy-2,3-dihydro-1,3-thiazole-2-carboximidamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N'-hydroxy-2,3-dihydro-1,3-thiazole-2-carboximidamide |
|---|---|
| PubChem CID | 142831926 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N'-hydroxy-2,3-dihydro-1,3-thiazole-2-carboximidamide |
| SMILES | COc1ccc(C2=CSC(/C(N)=N/O)N2)cc1OC |
| InChI | InChI=1S/C12H15N3O3S/c1-17-9-4-3-7(5-10(9)18-2)8-6-19-12(14-8)11(13)15-16/h3-6,12,14,16H,1-2H3,(H2,13,15) |
| InChIKey | FRZUQIMEEMHFHN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|