About (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium
(E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium (PubChem CID 135743957) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium.
Molecular Properties
| Compound Name | (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium |
| PubChem CID | 135743957 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium |
| SMILES | CCc1cccc(CC)c1/[N+]([O-])=[N+](\[O-])c1c(CC)cccc1CC |
| InChI | InChI=1S/C20H26N2O2/c1-5-15-11-9-12-16(6-2)19(15)21(23)22(24)20-17(7-3)13-10-14-18(20)8-4/h9-14H,5-8H2,1-4H3/b22-21+ |
| InChIKey | OJKAXEMRBBHQLV-QURGRASLSA-N |
| XLogP | 5.37 |
| TPSA | 52.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium?
The IUPAC name of (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium (CID 135743957) is (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium.
What is the SMILES notation for (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium?
The canonical SMILES for (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium is CCc1cccc(CC)c1/[N+]([O-])=[N+](\[O-])c1c(CC)cccc1CC.
What is the InChIKey of (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium?
The InChIKey is OJKAXEMRBBHQLV-QURGRASLSA-N. The full InChI is InChI=1S/C20H26N2O2/c1-5-15-11-9-12-16(6-2)19(15)21(23)22(24)20-17(7-3)13-10-14-18(20)8-4/h9-14H,5-8H2,1-4H3/b22-21+.
What are the key properties of (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium?
(E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium has a molecular weight of 326.44 g/mol, XLogP of 5.37, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-(2,6-diethylphenyl)-[(2,6-diethylphenyl)-oxidoazaniumylidene]-oxidoazanium is sourced from PubChem (CID 135743957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).