C21H21N7OS — CID 135745445
N-(3,4-dimethylphenyl)-2-[[5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 135745445) has the molecular formula C21H21N7OS and a molecular weight of 419.51 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[[5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[[5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135745445 |
| Molecular Formula | C21H21N7OS |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[[5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2n[nH]c(N/N=C/c3c[nH]c4ccccc34)n2)cc1C |
| InChI | InChI=1S/C21H21N7OS/c1-13-7-8-16(9-14(13)2)24-19(29)12-30-21-25-20(27-28-21)26-23-11-15-10-22-18-6-4-3-5-17(15)18/h3-11,22H,12H2,1-2H3,(H,24,29)(H2,25,26,27,28)/b23-11+ |
| InChIKey | MQZYOQLTIONWNQ-FOKLQQMPSA-N |
| XLogP | 4.08 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|