C52H44N4O3 — CID 135746396
3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-5-yl)oxepine-2,7-diol (PubChem CID 135746396) has the molecular formula C52H44N4O3 and a molecular weight of 772.95 g/mol. Its IUPAC name is 3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-5-yl)oxepine-2,7-diol.
| Compound Name | 3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-5-yl)oxepine-2,7-diol |
|---|---|
| PubChem CID | 135746396 |
| Molecular Formula | C52H44N4O3 |
| Molecular Weight | 772.95 g/mol |
| Exact Mass | 772.34 |
| IUPAC Name | 3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-5-yl)oxepine-2,7-diol |
| SMILES | CC(C)(C)C1=C(O)OC(O)=C(C(C)(C)C)C(/C2=C3\C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC2=N3)=C1 |
| InChI | InChI=1S/C52H44N4O3/c1-51(2,3)35-30-34(48(52(4,5)6)50(58)59-49(35)57)47-42-28-26-40(55-42)45(32-18-12-8-13-19-32)38-24-22-36(53-38)44(31-16-10-7-11-17-31)37-23-25-39(54-37)46(33-20-14-9-15-21-33)41-27-29-43(47)56-41/h7-30,57-58H,1-6H3/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43- |
| InChIKey | KXFRELIBCMMUCY-ZQANTMHOSA-N |
| XLogP | 12.12 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.95 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |