C15H17N5O5 — CID 135746973
2-[2-[(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)methylamino]-2-oxoethoxy]ethyl benzoate (PubChem CID 135746973) has the molecular formula C15H17N5O5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-[2-[(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)methylamino]-2-oxoethoxy]ethyl benzoate.
| Compound Name | 2-[2-[(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)methylamino]-2-oxoethoxy]ethyl benzoate |
|---|---|
| PubChem CID | 135746973 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[2-[(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)methylamino]-2-oxoethoxy]ethyl benzoate |
| SMILES | Nc1nnc(CNC(=O)COCCOC(=O)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H17N5O5/c16-15-18-13(22)11(19-20-15)8-17-12(21)9-24-6-7-25-14(23)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,17,21)(H3,16,18,20,22) |
| InChIKey | PGSCDYKVYCUWMP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|