C24H28N3O2+ — CID 135750576
diethyl-[2-[[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzoyl]amino]ethyl]azanium (PubChem CID 135750576) has the molecular formula C24H28N3O2+ and a molecular weight of 390.51 g/mol. Its IUPAC name is diethyl-[2-[[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzoyl]amino]ethyl]azanium.
| Compound Name | diethyl-[2-[[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 135750576 |
| Molecular Formula | C24H28N3O2+ |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | diethyl-[2-[[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzoyl]amino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCNC(=O)c1ccc(/N=C/c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-3-27(4-2)16-15-25-24(29)19-9-12-20(13-10-19)26-17-22-21-8-6-5-7-18(21)11-14-23(22)28/h5-14,17,28H,3-4,15-16H2,1-2H3,(H,25,29)/p+1/b26-17+ |
| InChIKey | LWZXYSNLIMZLKP-YZSQISJMSA-O |
| XLogP | 2.95 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|