C27H30N2O5S — CID 135465718
3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]naphthalene-1-sulfonate;triethylazanium (PubChem CID 135465718) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]naphthalene-1-sulfonate;triethylazanium.
| Compound Name | 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]naphthalene-1-sulfonate;triethylazanium |
|---|---|
| PubChem CID | 135465718 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]naphthalene-1-sulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])c1cc(O)c(/N=C/c2c(O)ccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C21H15NO5S.C6H15N/c23-18-10-9-13-5-1-2-6-14(13)17(18)12-22-21-16-8-4-3-7-15(16)20(11-19(21)24)28(25,26)27;1-4-7(5-2)6-3/h1-12,23-24H,(H,25,26,27);4-6H2,1-3H3/b22-12+; |
| InChIKey | NNHNDXYVINOEAI-RSRKELGKSA-N |
| XLogP | 3.99 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|