C17H15N5O4S — CID 135753584
ethyl (Z)-2-[[(E)-2-cyano-2-pyridin-2-ylethenyl]amino]-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enoate (PubChem CID 135753584) has the molecular formula C17H15N5O4S and a molecular weight of 385.41 g/mol. Its IUPAC name is ethyl (Z)-2-[[(E)-2-cyano-2-pyridin-2-ylethenyl]amino]-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enoate.
| Compound Name | ethyl (Z)-2-[[(E)-2-cyano-2-pyridin-2-ylethenyl]amino]-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 135753584 |
| Molecular Formula | C17H15N5O4S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | ethyl (Z)-2-[[(E)-2-cyano-2-pyridin-2-ylethenyl]amino]-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1c(O)[nH]c(=S)[nH]c1=O)N/C=C(/C#N)c1ccccn1 |
| InChI | InChI=1S/C17H15N5O4S/c1-2-26-16(25)13(7-11-14(23)21-17(27)22-15(11)24)20-9-10(8-18)12-5-3-4-6-19-12/h3-7,9,20H,2H2,1H3,(H3,21,22,23,24,27)/b10-9-,13-7- |
| InChIKey | NKUZLZASHPRBBI-OWJONZBZSA-N |
| XLogP | 1.59 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|