C17H17N3O2 — CID 92534718
ethyl 5-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 92534718) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 5-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 92534718 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl 5-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C=C(\C#N)c2ccccn2)c1C |
| InChI | InChI=1S/C17H17N3O2/c1-4-22-17(21)16-11(2)15(20-12(16)3)9-13(10-18)14-7-5-6-8-19-14/h5-9,20H,4H2,1-3H3/b13-9+ |
| InChIKey | NQSLZIJRWVAPQI-UKTHLTGXSA-N |
| XLogP | 3.27 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|