C7H8N4O2 — CID 135755331
6-methyl-3,5,6,8-tetrahydropteridine-4,7-dione (PubChem CID 135755331) has the molecular formula C7H8N4O2 and a molecular weight of 180.17 g/mol. Its IUPAC name is 6-methyl-3,5,6,8-tetrahydropteridine-4,7-dione.
| Compound Name | 6-methyl-3,5,6,8-tetrahydropteridine-4,7-dione |
|---|---|
| PubChem CID | 135755331 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-methyl-3,5,6,8-tetrahydropteridine-4,7-dione |
| SMILES | CC1Nc2c(nc[nH]c2=O)NC1=O |
| InChI | InChI=1S/C7H8N4O2/c1-3-6(12)11-5-4(10-3)7(13)9-2-8-5/h2-3,10H,1H3,(H2,8,9,11,12,13) |
| InChIKey | XRLAOFHTEONXDI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |