C18H22N2O4S — CID 135758646
5-[(2-hydroxy-4-propoxyphenyl)methylideneamino]-N,2-dimethylbenzenesulfonamide (PubChem CID 135758646) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 5-[(2-hydroxy-4-propoxyphenyl)methylideneamino]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-[(2-hydroxy-4-propoxyphenyl)methylideneamino]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135758646 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5-[(2-hydroxy-4-propoxyphenyl)methylideneamino]-N,2-dimethylbenzenesulfonamide |
| SMILES | CCCOc1ccc(/C=N/c2ccc(C)c(S(=O)(=O)NC)c2)c(O)c1 |
| InChI | InChI=1S/C18H22N2O4S/c1-4-9-24-16-8-6-14(17(21)11-16)12-20-15-7-5-13(2)18(10-15)25(22,23)19-3/h5-8,10-12,19,21H,4,9H2,1-3H3/b20-12+ |
| InChIKey | LWJGKHNALSDWGI-UDWIEESQSA-N |
| XLogP | 3.15 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|