C14H11N3O3 — CID 135765023
ethyl 4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylate (PubChem CID 135765023) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is ethyl 4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylate.
| Compound Name | ethyl 4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 135765023 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | ethyl 4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2nc3ccccc3cc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H11N3O3/c1-2-20-14(19)12-16-11-9(13(18)17-12)7-8-5-3-4-6-10(8)15-11/h3-7H,2H2,1H3,(H,15,16,17,18) |
| InChIKey | JBRDALJZMUEMPV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|