C19H17ClN4O2 — CID 135772723
N-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]phenyl]-3-chloropropanamide (PubChem CID 135772723) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is N-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]phenyl]-3-chloropropanamide.
| Compound Name | N-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]phenyl]-3-chloropropanamide |
|---|---|
| PubChem CID | 135772723 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[4-[(2-amino-8-hydroxynaphthalen-1-yl)diazenyl]phenyl]-3-chloropropanamide |
| SMILES | Nc1ccc2cccc(O)c2c1/N=N/c1ccc(NC(=O)CCCl)cc1 |
| InChI | InChI=1S/C19H17ClN4O2/c20-11-10-17(26)22-13-5-7-14(8-6-13)23-24-19-15(21)9-4-12-2-1-3-16(25)18(12)19/h1-9,25H,10-11,21H2,(H,22,26)/b24-23+ |
| InChIKey | ZYSJEAAPHBPTPT-WCWDXBQESA-N |
| XLogP | 5.11 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|