C20H20ClN4O2+ — CID 143834307
[8-[[4-[(2-chloroacetyl)amino]phenyl]diazenyl]-7-hydroxynaphthalen-2-yl]-dimethylazanium (PubChem CID 143834307) has the molecular formula C20H20ClN4O2+ and a molecular weight of 383.86 g/mol. Its IUPAC name is [8-[[4-[(2-chloroacetyl)amino]phenyl]diazenyl]-7-hydroxynaphthalen-2-yl]-dimethylazanium.
| Compound Name | [8-[[4-[(2-chloroacetyl)amino]phenyl]diazenyl]-7-hydroxynaphthalen-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 143834307 |
| Molecular Formula | C20H20ClN4O2+ |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [8-[[4-[(2-chloroacetyl)amino]phenyl]diazenyl]-7-hydroxynaphthalen-2-yl]-dimethylazanium |
| SMILES | C[NH+](C)c1ccc2ccc(O)c(/N=N/c3ccc(NC(=O)CCl)cc3)c2c1 |
| InChI | InChI=1S/C20H19ClN4O2/c1-25(2)16-9-3-13-4-10-18(26)20(17(13)11-16)24-23-15-7-5-14(6-8-15)22-19(27)12-21/h3-11,26H,12H2,1-2H3,(H,22,27)/p+1/b24-23+ |
| InChIKey | XIXIKHZIDIZDBE-WCWDXBQESA-O |
| XLogP | 3.91 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|