C20H30N5O2+ — CID 135780917
6-[(4-methoxyphenyl)methyl]-3-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)amino]-4H-1,2,4-triazin-5-one (PubChem CID 135780917) has the molecular formula C20H30N5O2+ and a molecular weight of 372.49 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methyl]-3-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)amino]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(4-methoxyphenyl)methyl]-3-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)amino]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135780917 |
| Molecular Formula | C20H30N5O2+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 6-[(4-methoxyphenyl)methyl]-3-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)amino]-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(Cc2nnc(NC3CC(C)(C)[NH2+]C(C)(C)C3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H29N5O2/c1-19(2)11-14(12-20(3,4)25-19)21-18-22-17(26)16(23-24-18)10-13-6-8-15(27-5)9-7-13/h6-9,14,25H,10-12H2,1-5H3,(H2,21,22,24,26)/p+1 |
| InChIKey | XXDXODIQKZSFRN-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |