C21H23N3O5S — CID 135781185
ethyl (2Z)-4-ethyl-2-(4-methoxyphenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate (PubChem CID 135781185) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is ethyl (2Z)-4-ethyl-2-(4-methoxyphenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate.
| Compound Name | ethyl (2Z)-4-ethyl-2-(4-methoxyphenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 135781185 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | ethyl (2Z)-4-ethyl-2-(4-methoxyphenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CC)Nc2ccccc2N/C1=N\S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23N3O5S/c1-4-16-19(21(25)29-5-2)20(23-18-9-7-6-8-17(18)22-16)24-30(26,27)15-12-10-14(28-3)11-13-15/h6-13,22H,4-5H2,1-3H3,(H,23,24) |
| InChIKey | KIZHSBCEPDYTFV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|