C20H19N3O6S — CID 136577221
3-[(Z)-(3-ethoxycarbonyl-4-methyl-1,5-dihydro-1,5-benzodiazepin-2-ylidene)amino]sulfonylbenzoic acid (PubChem CID 136577221) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is 3-[(Z)-(3-ethoxycarbonyl-4-methyl-1,5-dihydro-1,5-benzodiazepin-2-ylidene)amino]sulfonylbenzoic acid.
| Compound Name | 3-[(Z)-(3-ethoxycarbonyl-4-methyl-1,5-dihydro-1,5-benzodiazepin-2-ylidene)amino]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 136577221 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 3-[(Z)-(3-ethoxycarbonyl-4-methyl-1,5-dihydro-1,5-benzodiazepin-2-ylidene)amino]sulfonylbenzoic acid |
| SMILES | CCOC(=O)C1=C(C)Nc2ccccc2N/C1=N\S(=O)(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H19N3O6S/c1-3-29-20(26)17-12(2)21-15-9-4-5-10-16(15)22-18(17)23-30(27,28)14-8-6-7-13(11-14)19(24)25/h4-11,21H,3H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | CJBIXDWTSLHELX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|