C19H16F3N3O4S — CID 135973834
ethyl 4-methyl-2-(2,3,4-trifluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate (PubChem CID 135973834) has the molecular formula C19H16F3N3O4S and a molecular weight of 439.42 g/mol. Its IUPAC name is ethyl 4-methyl-2-(2,3,4-trifluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate.
| Compound Name | ethyl 4-methyl-2-(2,3,4-trifluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 135973834 |
| Molecular Formula | C19H16F3N3O4S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | ethyl 4-methyl-2-(2,3,4-trifluorophenyl)sulfonylimino-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2ccccc2NC1=NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H16F3N3O4S/c1-3-29-19(26)15-10(2)23-12-6-4-5-7-13(12)24-18(15)25-30(27,28)14-9-8-11(20)16(21)17(14)22/h4-9,23H,3H2,1-2H3,(H,24,25) |
| InChIKey | ZNYDYLADEXIRLW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|