C23H26N4O2S — CID 135789317
3-(2,3-dimethylphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea (PubChem CID 135789317) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea.
| Compound Name | 3-(2,3-dimethylphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 135789317 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1-[[(2R)-oxolan-2-yl]methyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
| SMILES | Cc1cccc(NC(=S)N(Cc2nc3ccccc3c(=O)[nH]2)C[C@H]2CCCO2)c1C |
| InChI | InChI=1S/C23H26N4O2S/c1-15-7-5-11-19(16(15)2)25-23(30)27(13-17-8-6-12-29-17)14-21-24-20-10-4-3-9-18(20)22(28)26-21/h3-5,7,9-11,17H,6,8,12-14H2,1-2H3,(H,25,30)(H,24,26,28)/t17-/m1/s1 |
| InChIKey | SYVRTMBCBMHXML-QGZVFWFLSA-N |
| XLogP | 3.92 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|