C18H15ClN6O2 — CID 135794880
4-chloro-N-[3-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl]benzamide (PubChem CID 135794880) has the molecular formula C18H15ClN6O2 and a molecular weight of 382.81 g/mol. Its IUPAC name is 4-chloro-N-[3-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[3-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 135794880 |
| Molecular Formula | C18H15ClN6O2 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 4-chloro-N-[3-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]phenyl]benzamide |
| SMILES | Cc1nnc(N/N=C/c2cccc(NC(=O)c3ccc(Cl)cc3)c2)[nH]c1=O |
| InChI | InChI=1S/C18H15ClN6O2/c1-11-16(26)22-18(25-23-11)24-20-10-12-3-2-4-15(9-12)21-17(27)13-5-7-14(19)8-6-13/h2-10H,1H3,(H,21,27)(H2,22,24,25,26)/b20-10+ |
| InChIKey | GBNXMHBZZUCTQZ-KEBDBYFISA-N |
| XLogP | 2.83 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|