C16H27NO5 — CID 135798948
dimethyl (Z,2S,7S)-4-amino-5-oxo-2,7-di(propan-2-yl)oct-3-enedioate (PubChem CID 135798948) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is dimethyl (Z,2S,7S)-4-amino-5-oxo-2,7-di(propan-2-yl)oct-3-enedioate.
| Compound Name | dimethyl (Z,2S,7S)-4-amino-5-oxo-2,7-di(propan-2-yl)oct-3-enedioate |
|---|---|
| PubChem CID | 135798948 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | dimethyl (Z,2S,7S)-4-amino-5-oxo-2,7-di(propan-2-yl)oct-3-enedioate |
| SMILES | COC(=O)[C@@H](CC(=O)/C(N)=C/[C@@H](C(=O)OC)C(C)C)C(C)C |
| InChI | InChI=1S/C16H27NO5/c1-9(2)11(15(19)21-5)7-13(17)14(18)8-12(10(3)4)16(20)22-6/h7,9-12H,8,17H2,1-6H3/b13-7-/t11-,12+/m1/s1 |
| InChIKey | LMMVDSGSHYIJGS-XNAKUGGASA-N |
| XLogP | 1.68 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|