C14H15N2O4+ — CID 135799616
2-methylprop-2-enyl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate (PubChem CID 135799616) has the molecular formula C14H15N2O4+ and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-methylprop-2-enyl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate.
| Compound Name | 2-methylprop-2-enyl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 135799616 |
| Molecular Formula | C14H15N2O4+ |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-methylprop-2-enyl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate |
| SMILES | C=C(C)COC(=O)C1=C[CH+]C=C/C1=N\N=CC(=O)OC |
| InChI | InChI=1S/C14H15N2O4/c1-10(2)9-20-14(18)11-6-4-5-7-12(11)16-15-8-13(17)19-3/h4-8H,1,9H2,2-3H3/q+1/b15-8?,16-12+ |
| InChIKey | MRTVGXZRTVDVSW-QCLCFKGTSA-N |
| XLogP | 1.41 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|