C12H10N2O2 — CID 140641210
methyl (1E,2Z,4Z,6Z)-1,2-benzodiazocine-10-carboxylate (PubChem CID 140641210) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is methyl (1E,2Z,4Z,6Z)-1,2-benzodiazocine-10-carboxylate.
| Compound Name | methyl (1E,2Z,4Z,6Z)-1,2-benzodiazocine-10-carboxylate |
|---|---|
| PubChem CID | 140641210 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | methyl (1E,2Z,4Z,6Z)-1,2-benzodiazocine-10-carboxylate |
| SMILES | COC(=O)c1cccc2/c1=N\N=C/C=C\C=2 |
| InChI | InChI=1S/C12H10N2O2/c1-16-12(15)10-7-4-6-9-5-2-3-8-13-14-11(9)10/h2-8H,1H3/b3-2-,5-2-,8-3-,9-5-,13-8-,14-11+,14-13- |
| InChIKey | XKPYHPLGXANCPT-KIHVVFGQSA-N |
| XLogP | 0.43 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |