C5H8N6O — CID 135804075
4-[2-(trideuteriomethylimino)hydrazinyl]-1H-imidazole-5-carboxamide (PubChem CID 135804075) has the molecular formula C5H8N6O and a molecular weight of 171.18 g/mol. Its IUPAC name is 4-[2-(trideuteriomethylimino)hydrazinyl]-1H-imidazole-5-carboxamide.
| Compound Name | 4-[2-(trideuteriomethylimino)hydrazinyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 135804075 |
| Molecular Formula | C5H8N6O |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4-[2-(trideuteriomethylimino)hydrazinyl]-1H-imidazole-5-carboxamide |
| SMILES | [2H]C([2H])([2H])/N=N/Nc1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C5H8N6O/c1-7-11-10-5-3(4(6)12)8-2-9-5/h2H,1H3,(H2,6,12)(H,7,10)(H,8,9)/i1D3 |
| InChIKey | MVBPAIHFZZKRGD-FIBGUPNXSA-N |
| XLogP | -0.08 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|