C22H31Cl2N7O5 — CID 135509542
ethyl acetate;methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[(5-carbamoyl-1H-imidazol-4-yl)amino]diazenyl]propanoate (PubChem CID 135509542) has the molecular formula C22H31Cl2N7O5 and a molecular weight of 544.44 g/mol. Its IUPAC name is ethyl acetate;methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[(5-carbamoyl-1H-imidazol-4-yl)amino]diazenyl]propanoate.
| Compound Name | ethyl acetate;methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[(5-carbamoyl-1H-imidazol-4-yl)amino]diazenyl]propanoate |
|---|---|
| PubChem CID | 135509542 |
| Molecular Formula | C22H31Cl2N7O5 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | ethyl acetate;methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[(5-carbamoyl-1H-imidazol-4-yl)amino]diazenyl]propanoate |
| SMILES | CCOC(C)=O.COC(=O)C(Cc1ccc(N(CCCl)CCCl)cc1)/N=N/Nc1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C18H23Cl2N7O3.C4H8O2/c1-30-18(29)14(24-26-25-17-15(16(21)28)22-11-23-17)10-12-2-4-13(5-3-12)27(8-6-19)9-7-20;1-3-6-4(2)5/h2-5,11,14H,6-10H2,1H3,(H2,21,28)(H,22,23)(H,24,25);3H2,1-2H3 |
| InChIKey | AAIVXYAICMGKAK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 164.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|