C17H14BrN5O3 — CID 135804235
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide (PubChem CID 135804235) has the molecular formula C17H14BrN5O3 and a molecular weight of 416.24 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide |
|---|---|
| PubChem CID | 135804235 |
| Molecular Formula | C17H14BrN5O3 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide |
| SMILES | O=C(COc1ncn(-c2ccccc2)n1)N/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C17H14BrN5O3/c18-13-6-7-15(24)12(8-13)9-20-21-16(25)10-26-17-19-11-23(22-17)14-4-2-1-3-5-14/h1-9,11,24H,10H2,(H,21,25)/b20-9+ |
| InChIKey | UBPJAJFUQCCLFW-AWQFTUOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|