C17H13BrN6O5 — CID 135804158
N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide (PubChem CID 135804158) has the molecular formula C17H13BrN6O5 and a molecular weight of 461.23 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide |
|---|---|
| PubChem CID | 135804158 |
| Molecular Formula | C17H13BrN6O5 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]acetamide |
| SMILES | O=C(COc1ncn(-c2ccccc2)n1)N/N=C/c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H13BrN6O5/c18-12-6-11(16(26)14(7-12)24(27)28)8-20-21-15(25)9-29-17-19-10-23(22-17)13-4-2-1-3-5-13/h1-8,10,26H,9H2,(H,21,25)/b20-8+ |
| InChIKey | KHGPPCDHYAXLEL-DNTJNYDQSA-N |
| XLogP | 2.17 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|